C35H68O7SSi3 — CID 131749894
2-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-methoxyoxolan-2-yl]ethoxy-triethylsilane (PubChem CID 131749894) has the molecular formula C35H68O7SSi3 and a molecular weight of 717.25 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-methoxyoxolan-2-yl]ethoxy-triethylsilane.
| Compound Name | 2-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-methoxyoxolan-2-yl]ethoxy-triethylsilane |
|---|---|
| PubChem CID | 131749894 |
| Molecular Formula | C35H68O7SSi3 |
| Molecular Weight | 717.25 g/mol |
| Exact Mass | 716.40 |
| IUPAC Name | 2-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-methoxyoxolan-2-yl]ethoxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)OCC[C@@H]1O[C@H](C[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@H](OC)[C@H]1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C35H68O7SSi3/c1-15-46(16-2,17-3)39-24-23-31-30(27-43(36,37)29-21-19-18-20-22-29)33(38-10)32(41-31)25-28(42-45(13,14)35(7,8)9)26-40-44(11,12)34(4,5)6/h18-22,28,30-33H,15-17,23-27H2,1-14H3/t28-,30-,31-,32+,33+/m0/s1 |
| InChIKey | KJVHAMFRKYVAHH-VYIXFUBHSA-N |
| XLogP | 9.07 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.25 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|