About 7-bromo-2,6-dichloroquinazoline
7-bromo-2,6-dichloroquinazoline (PubChem CID 131750244) has the molecular formula C8H3BrCl2N2
and a molecular weight of 277.94 g/mol. Its IUPAC name is 7-bromo-2,6-dichloroquinazoline.
Molecular Properties
| Compound Name | 7-bromo-2,6-dichloroquinazoline |
| PubChem CID | 131750244 |
| Molecular Formula | C8H3BrCl2N2 |
| Molecular Weight | 277.94 g/mol |
| Exact Mass | 275.89 |
| IUPAC Name | 7-bromo-2,6-dichloroquinazoline |
| SMILES | Clc1ncc2cc(Cl)c(Br)cc2n1 |
| InChI | InChI=1S/C8H3BrCl2N2/c9-5-2-7-4(1-6(5)10)3-12-8(11)13-7/h1-3H |
| InChIKey | MCADHWSIBXZPID-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.94 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-2,6-dichloroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-2,6-dichloroquinazoline?
The IUPAC name of 7-bromo-2,6-dichloroquinazoline (CID 131750244) is 7-bromo-2,6-dichloroquinazoline.
What is the SMILES notation for 7-bromo-2,6-dichloroquinazoline?
The canonical SMILES for 7-bromo-2,6-dichloroquinazoline is Clc1ncc2cc(Cl)c(Br)cc2n1.
What is the InChIKey of 7-bromo-2,6-dichloroquinazoline?
The InChIKey is MCADHWSIBXZPID-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3BrCl2N2/c9-5-2-7-4(1-6(5)10)3-12-8(11)13-7/h1-3H.
What are the key properties of 7-bromo-2,6-dichloroquinazoline?
7-bromo-2,6-dichloroquinazoline has a molecular weight of 277.94 g/mol, XLogP of 3.70, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-2,6-dichloroquinazoline is sourced from PubChem (CID 131750244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).