About (Z)-1,7-diphenylhept-6-en-3-ol
(Z)-1,7-diphenylhept-6-en-3-ol (PubChem CID 131750968) has the molecular formula C19H22O
and a molecular weight of 266.38 g/mol. Its IUPAC name is (Z)-1,7-diphenylhept-6-en-3-ol.
Molecular Properties
| Compound Name | (Z)-1,7-diphenylhept-6-en-3-ol |
| PubChem CID | 131750968 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | (Z)-1,7-diphenylhept-6-en-3-ol |
| SMILES | OC(CC/C=C\c1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C19H22O/c20-19(16-15-18-11-5-2-6-12-18)14-8-7-13-17-9-3-1-4-10-17/h1-7,9-13,19-20H,8,14-16H2/b13-7- |
| InChIKey | DPRCKWANIKZGTF-QPEQYQDCSA-N |
| XLogP | 4.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (Z)-1,7-diphenylhept-6-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,7-diphenylhept-6-en-3-ol?
The IUPAC name of (Z)-1,7-diphenylhept-6-en-3-ol (CID 131750968) is (Z)-1,7-diphenylhept-6-en-3-ol.
What is the SMILES notation for (Z)-1,7-diphenylhept-6-en-3-ol?
The canonical SMILES for (Z)-1,7-diphenylhept-6-en-3-ol is OC(CC/C=C\c1ccccc1)CCc1ccccc1.
What is the InChIKey of (Z)-1,7-diphenylhept-6-en-3-ol?
The InChIKey is DPRCKWANIKZGTF-QPEQYQDCSA-N. The full InChI is InChI=1S/C19H22O/c20-19(16-15-18-11-5-2-6-12-18)14-8-7-13-17-9-3-1-4-10-17/h1-7,9-13,19-20H,8,14-16H2/b13-7-.
What are the key properties of (Z)-1,7-diphenylhept-6-en-3-ol?
(Z)-1,7-diphenylhept-6-en-3-ol has a molecular weight of 266.38 g/mol, XLogP of 4.47, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,7-diphenylhept-6-en-3-ol is sourced from PubChem (CID 131750968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).