C20H19NO5 — CID 131750990
6,11-dihydroxy-10-methoxy-3,3,12-trimethylpyrano[2,3-c]acridin-7-one (PubChem CID 131750990) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is 6,11-dihydroxy-10-methoxy-3,3,12-trimethylpyrano[2,3-c]acridin-7-one.
| Compound Name | 6,11-dihydroxy-10-methoxy-3,3,12-trimethylpyrano[2,3-c]acridin-7-one |
|---|---|
| PubChem CID | 131750990 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 6,11-dihydroxy-10-methoxy-3,3,12-trimethylpyrano[2,3-c]acridin-7-one |
| SMILES | COc1ccc2c(=O)c3c(O)cc4c(c3n(C)c2c1O)C=CC(C)(C)O4 |
| InChI | InChI=1S/C20H19NO5/c1-20(2)8-7-10-14(26-20)9-12(22)15-16(10)21(3)17-11(18(15)23)5-6-13(25-4)19(17)24/h5-9,22,24H,1-4H3 |
| InChIKey | AOYGNVHBYGMHGR-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|