About 2-(hydroxymethyl)-6-[(E)-2-methylbut-2-enoxy]oxane-3,4,5-triol
2-(hydroxymethyl)-6-[(E)-2-methylbut-2-enoxy]oxane-3,4,5-triol (PubChem CID 131751366) has the molecular formula C11H20O6
and a molecular weight of 248.27 g/mol. Its IUPAC name is 2-(hydroxymethyl)-6-[(E)-2-methylbut-2-enoxy]oxane-3,4,5-triol.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-6-[(E)-2-methylbut-2-enoxy]oxane-3,4,5-triol |
| PubChem CID | 131751366 |
| Molecular Formula | C11H20O6 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-(hydroxymethyl)-6-[(E)-2-methylbut-2-enoxy]oxane-3,4,5-triol |
| SMILES | C/C=C(\C)COC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C11H20O6/c1-3-6(2)5-16-11-10(15)9(14)8(13)7(4-12)17-11/h3,7-15H,4-5H2,1-2H3/b6-3+ |
| InChIKey | RQSHFEQQQBCYNX-ZZXKWVIFSA-N |
| XLogP | -1.23 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxymethyl)-6-[(E)-2-methylbut-2-enoxy]oxane-3,4,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-6-[(E)-2-methylbut-2-enoxy]oxane-3,4,5-triol?
The IUPAC name of 2-(hydroxymethyl)-6-[(E)-2-methylbut-2-enoxy]oxane-3,4,5-triol (CID 131751366) is 2-(hydroxymethyl)-6-[(E)-2-methylbut-2-enoxy]oxane-3,4,5-triol.
What is the SMILES notation for 2-(hydroxymethyl)-6-[(E)-2-methylbut-2-enoxy]oxane-3,4,5-triol?
The canonical SMILES for 2-(hydroxymethyl)-6-[(E)-2-methylbut-2-enoxy]oxane-3,4,5-triol is C/C=C(\C)COC1OC(CO)C(O)C(O)C1O.
What is the InChIKey of 2-(hydroxymethyl)-6-[(E)-2-methylbut-2-enoxy]oxane-3,4,5-triol?
The InChIKey is RQSHFEQQQBCYNX-ZZXKWVIFSA-N. The full InChI is InChI=1S/C11H20O6/c1-3-6(2)5-16-11-10(15)9(14)8(13)7(4-12)17-11/h3,7-15H,4-5H2,1-2H3/b6-3+.
What are the key properties of 2-(hydroxymethyl)-6-[(E)-2-methylbut-2-enoxy]oxane-3,4,5-triol?
2-(hydroxymethyl)-6-[(E)-2-methylbut-2-enoxy]oxane-3,4,5-triol has a molecular weight of 248.27 g/mol, XLogP of -1.23, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-6-[(E)-2-methylbut-2-enoxy]oxane-3,4,5-triol is sourced from PubChem (CID 131751366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).