C30H52O — CID 131751389
(E)-11-(2,4a,7,7-tetramethyl-3,4,5,6,8,8a-hexahydronaphthalen-1-yl)-4,8-dimethyl-5-propan-2-ylideneundec-8-en-1-ol (PubChem CID 131751389) has the molecular formula C30H52O and a molecular weight of 428.75 g/mol. Its IUPAC name is (E)-11-(2,4a,7,7-tetramethyl-3,4,5,6,8,8a-hexahydronaphthalen-1-yl)-4,8-dimethyl-5-propan-2-ylideneundec-8-en-1-ol.
| Compound Name | (E)-11-(2,4a,7,7-tetramethyl-3,4,5,6,8,8a-hexahydronaphthalen-1-yl)-4,8-dimethyl-5-propan-2-ylideneundec-8-en-1-ol |
|---|---|
| PubChem CID | 131751389 |
| Molecular Formula | C30H52O |
| Molecular Weight | 428.75 g/mol |
| Exact Mass | 428.40 |
| IUPAC Name | (E)-11-(2,4a,7,7-tetramethyl-3,4,5,6,8,8a-hexahydronaphthalen-1-yl)-4,8-dimethyl-5-propan-2-ylideneundec-8-en-1-ol |
| SMILES | CC(C)=C(CC/C(C)=C/CCC1=C(C)CCC2(C)CCC(C)(C)CC12)C(C)CCCO |
| InChI | InChI=1S/C30H52O/c1-22(2)26(24(4)12-10-20-31)15-14-23(3)11-9-13-27-25(5)16-17-30(8)19-18-29(6,7)21-28(27)30/h11,24,28,31H,9-10,12-21H2,1-8H3/b23-11+ |
| InChIKey | KIXZDOGILWAHJH-FOKLQQMPSA-N |
| XLogP | 9.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.75 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|