C15H22O4 — CID 131751394
4,8-dihydroxy-3,6-dimethyl-9-methylidene-3,3a,4,5,6,6a,7,8,9a,9b-decahydroazuleno[4,5-b]furan-2-one (PubChem CID 131751394) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 4,8-dihydroxy-3,6-dimethyl-9-methylidene-3,3a,4,5,6,6a,7,8,9a,9b-decahydroazuleno[4,5-b]furan-2-one.
| Compound Name | 4,8-dihydroxy-3,6-dimethyl-9-methylidene-3,3a,4,5,6,6a,7,8,9a,9b-decahydroazuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 131751394 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 4,8-dihydroxy-3,6-dimethyl-9-methylidene-3,3a,4,5,6,6a,7,8,9a,9b-decahydroazuleno[4,5-b]furan-2-one |
| SMILES | C=C1C(O)CC2C(C)CC(O)C3C(C)C(=O)OC3C12 |
| InChI | InChI=1S/C15H22O4/c1-6-4-11(17)13-8(3)15(18)19-14(13)12-7(2)10(16)5-9(6)12/h6,8-14,16-17H,2,4-5H2,1,3H3 |
| InChIKey | IBIJTDJAWRYXRF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|