About [5-[(Z)-3,4-dihydro-2H-pyridin-5-ylidenemethyl]furan-2-yl]methanol
[5-[(Z)-3,4-dihydro-2H-pyridin-5-ylidenemethyl]furan-2-yl]methanol (PubChem CID 131751455) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is [5-[(Z)-3,4-dihydro-2H-pyridin-5-ylidenemethyl]furan-2-yl]methanol.
Molecular Properties
| Compound Name | [5-[(Z)-3,4-dihydro-2H-pyridin-5-ylidenemethyl]furan-2-yl]methanol |
| PubChem CID | 131751455 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | [5-[(Z)-3,4-dihydro-2H-pyridin-5-ylidenemethyl]furan-2-yl]methanol |
| SMILES | OCc1ccc(/C=C2\C=NCCC2)o1 |
| InChI | InChI=1S/C11H13NO2/c13-8-11-4-3-10(14-11)6-9-2-1-5-12-7-9/h3-4,6-7,13H,1-2,5,8H2/b9-6- |
| InChIKey | HKIPZBSQJPFABU-TWGQIWQCSA-N |
| XLogP | 2.02 |
| TPSA | 45.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-[(Z)-3,4-dihydro-2H-pyridin-5-ylidenemethyl]furan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(Z)-3,4-dihydro-2H-pyridin-5-ylidenemethyl]furan-2-yl]methanol?
The IUPAC name of [5-[(Z)-3,4-dihydro-2H-pyridin-5-ylidenemethyl]furan-2-yl]methanol (CID 131751455) is [5-[(Z)-3,4-dihydro-2H-pyridin-5-ylidenemethyl]furan-2-yl]methanol.
What is the SMILES notation for [5-[(Z)-3,4-dihydro-2H-pyridin-5-ylidenemethyl]furan-2-yl]methanol?
The canonical SMILES for [5-[(Z)-3,4-dihydro-2H-pyridin-5-ylidenemethyl]furan-2-yl]methanol is OCc1ccc(/C=C2\C=NCCC2)o1.
What is the InChIKey of [5-[(Z)-3,4-dihydro-2H-pyridin-5-ylidenemethyl]furan-2-yl]methanol?
The InChIKey is HKIPZBSQJPFABU-TWGQIWQCSA-N. The full InChI is InChI=1S/C11H13NO2/c13-8-11-4-3-10(14-11)6-9-2-1-5-12-7-9/h3-4,6-7,13H,1-2,5,8H2/b9-6-.
What are the key properties of [5-[(Z)-3,4-dihydro-2H-pyridin-5-ylidenemethyl]furan-2-yl]methanol?
[5-[(Z)-3,4-dihydro-2H-pyridin-5-ylidenemethyl]furan-2-yl]methanol has a molecular weight of 191.23 g/mol, XLogP of 2.02, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(Z)-3,4-dihydro-2H-pyridin-5-ylidenemethyl]furan-2-yl]methanol is sourced from PubChem (CID 131751455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).