C13H11ClO — CID 131751511
(3E,11Z)-1-chlorotrideca-3,11-dien-5,7,9-triyn-2-ol (PubChem CID 131751511) has the molecular formula C13H11ClO and a molecular weight of 218.68 g/mol. Its IUPAC name is (3E,11Z)-1-chlorotrideca-3,11-dien-5,7,9-triyn-2-ol.
| Compound Name | (3E,11Z)-1-chlorotrideca-3,11-dien-5,7,9-triyn-2-ol |
|---|---|
| PubChem CID | 131751511 |
| Molecular Formula | C13H11ClO |
| Molecular Weight | 218.68 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | (3E,11Z)-1-chlorotrideca-3,11-dien-5,7,9-triyn-2-ol |
| SMILES | C/C=C\C#CC#CC#C/C=C/C(O)CCl |
| InChI | InChI=1S/C13H11ClO/c1-2-3-4-5-6-7-8-9-10-11-13(15)12-14/h2-3,10-11,13,15H,12H2,1H3/b3-2-,11-10+ |
| InChIKey | BWFFGWCCMCLGBQ-JSQGHLFOSA-N |
| XLogP | 1.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.68 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|