C16H26O8 — CID 131751869
[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (2Z)-6-hydroxy-2,6-dimethylocta-2,7-dienoate (PubChem CID 131751869) has the molecular formula C16H26O8 and a molecular weight of 346.38 g/mol. Its IUPAC name is [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (2Z)-6-hydroxy-2,6-dimethylocta-2,7-dienoate.
| Compound Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (2Z)-6-hydroxy-2,6-dimethylocta-2,7-dienoate |
|---|---|
| PubChem CID | 131751869 |
| Molecular Formula | C16H26O8 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (2Z)-6-hydroxy-2,6-dimethylocta-2,7-dienoate |
| SMILES | C=CC(C)(O)CC/C=C(/C)C(=O)OC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C16H26O8/c1-4-16(3,22)7-5-6-9(2)14(21)24-15-13(20)12(19)11(18)10(8-17)23-15/h4,6,10-13,15,17-20,22H,1,5,7-8H2,2-3H3/b9-6- |
| InChIKey | IVWJMPAYYVHQPT-TWGQIWQCSA-N |
| XLogP | -1.01 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|