C15H24O — CID 131751915
(5Z)-6,10,10-trimethylbicyclo[7.2.0]undec-5-ene-2-carbaldehyde (PubChem CID 131751915) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (5Z)-6,10,10-trimethylbicyclo[7.2.0]undec-5-ene-2-carbaldehyde.
| Compound Name | (5Z)-6,10,10-trimethylbicyclo[7.2.0]undec-5-ene-2-carbaldehyde |
|---|---|
| PubChem CID | 131751915 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (5Z)-6,10,10-trimethylbicyclo[7.2.0]undec-5-ene-2-carbaldehyde |
| SMILES | C/C1=C/CCC(C=O)C2CC(C)(C)C2CC1 |
| InChI | InChI=1S/C15H24O/c1-11-5-4-6-12(10-16)13-9-15(2,3)14(13)8-7-11/h5,10,12-14H,4,6-9H2,1-3H3/b11-5- |
| InChIKey | VLWNRFXSKLVVEB-WZUFQYTHSA-N |
| XLogP | 3.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|