C21H36O11 — CID 131752012
2-(6-ethenyl-2,2,6-trimethyloxan-3-yl)oxy-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxane-3,4,5-triol (PubChem CID 131752012) has the molecular formula C21H36O11 and a molecular weight of 464.51 g/mol. Its IUPAC name is 2-(6-ethenyl-2,2,6-trimethyloxan-3-yl)oxy-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxane-3,4,5-triol.
| Compound Name | 2-(6-ethenyl-2,2,6-trimethyloxan-3-yl)oxy-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 131752012 |
| Molecular Formula | C21H36O11 |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | 2-(6-ethenyl-2,2,6-trimethyloxan-3-yl)oxy-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxane-3,4,5-triol |
| SMILES | C=CC1(C)CCC(OC2OC(COC3OCC(O)C(O)C3O)C(O)C(O)C2O)C(C)(C)O1 |
| InChI | InChI=1S/C21H36O11/c1-5-21(4)7-6-12(20(2,3)32-21)31-19-17(27)15(25)14(24)11(30-19)9-29-18-16(26)13(23)10(22)8-28-18/h5,10-19,22-27H,1,6-9H2,2-4H3 |
| InChIKey | UXVKRHYINVOVAM-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 167.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|