C40H56O — CID 131752086
(6Z,8E,10E,12E,14Z,16E,18E,20E,22Z,24E)-2,6,10,14,19,23-hexamethyl-25-(2,6,6-trimethylcyclohexen-1-yl)pentacosa-1,6,8,10,12,14,16,18,20,22,24-undecaen-3-ol (PubChem CID 131752086) has the molecular formula C40H56O and a molecular weight of 552.89 g/mol. Its IUPAC name is (6Z,8E,10E,12E,14Z,16E,18E,20E,22Z,24E)-2,6,10,14,19,23-hexamethyl-25-(2,6,6-trimethylcyclohexen-1-yl)pentacosa-1,6,8,10,12,14,16,18,20,22,24-undecaen-3-ol.
| Compound Name | (6Z,8E,10E,12E,14Z,16E,18E,20E,22Z,24E)-2,6,10,14,19,23-hexamethyl-25-(2,6,6-trimethylcyclohexen-1-yl)pentacosa-1,6,8,10,12,14,16,18,20,22,24-undecaen-3-ol |
|---|---|
| PubChem CID | 131752086 |
| Molecular Formula | C40H56O |
| Molecular Weight | 552.89 g/mol |
| Exact Mass | 552.43 |
| IUPAC Name | (6Z,8E,10E,12E,14Z,16E,18E,20E,22Z,24E)-2,6,10,14,19,23-hexamethyl-25-(2,6,6-trimethylcyclohexen-1-yl)pentacosa-1,6,8,10,12,14,16,18,20,22,24-undecaen-3-ol |
| SMILES | C=C(C)C(O)CC/C(C)=C\C=C\C(C)=C\C=C\C(C)=C/C=C/C=C(C)/C=C/C=C(C)\C=C\C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C40H56O/c1-31(2)39(41)29-27-36(7)24-15-22-34(5)21-13-19-32(3)17-11-12-18-33(4)20-14-23-35(6)26-28-38-37(8)25-16-30-40(38,9)10/h11-15,17-24,26,28,39,41H,1,16,25,27,29-30H2,2-10H3/b12-11+,19-13+,20-14+,22-15+,28-26+,32-17-,33-18+,34-21+,35-23-,36-24- |
| InChIKey | QNZZRCYICVHHEE-RBXKNNLHSA-N |
| XLogP | 11.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.89 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|