About 5-(4-methylpent-3-enyl)-4,7-dihydrotrithiepine
5-(4-methylpent-3-enyl)-4,7-dihydrotrithiepine (PubChem CID 131752315) has the molecular formula C10H16S3
and a molecular weight of 232.44 g/mol. Its IUPAC name is 5-(4-methylpent-3-enyl)-4,7-dihydrotrithiepine.
Molecular Properties
| Compound Name | 5-(4-methylpent-3-enyl)-4,7-dihydrotrithiepine |
| PubChem CID | 131752315 |
| Molecular Formula | C10H16S3 |
| Molecular Weight | 232.44 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 5-(4-methylpent-3-enyl)-4,7-dihydrotrithiepine |
| SMILES | CC(C)=CCCC1=CCSSSC1 |
| InChI | InChI=1S/C10H16S3/c1-9(2)4-3-5-10-6-7-11-13-12-8-10/h4,6H,3,5,7-8H2,1-2H3 |
| InChIKey | SKNZXXPBLPEMIO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-methylpent-3-enyl)-4,7-dihydrotrithiepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-methylpent-3-enyl)-4,7-dihydrotrithiepine?
The IUPAC name of 5-(4-methylpent-3-enyl)-4,7-dihydrotrithiepine (CID 131752315) is 5-(4-methylpent-3-enyl)-4,7-dihydrotrithiepine.
What is the SMILES notation for 5-(4-methylpent-3-enyl)-4,7-dihydrotrithiepine?
The canonical SMILES for 5-(4-methylpent-3-enyl)-4,7-dihydrotrithiepine is CC(C)=CCCC1=CCSSSC1.
What is the InChIKey of 5-(4-methylpent-3-enyl)-4,7-dihydrotrithiepine?
The InChIKey is SKNZXXPBLPEMIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16S3/c1-9(2)4-3-5-10-6-7-11-13-12-8-10/h4,6H,3,5,7-8H2,1-2H3.
What are the key properties of 5-(4-methylpent-3-enyl)-4,7-dihydrotrithiepine?
5-(4-methylpent-3-enyl)-4,7-dihydrotrithiepine has a molecular weight of 232.44 g/mol, XLogP of 4.70, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-methylpent-3-enyl)-4,7-dihydrotrithiepine is sourced from PubChem (CID 131752315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).