About 10-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]decan-1-ol
10-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]decan-1-ol (PubChem CID 131752352) has the molecular formula C24H42O2
and a molecular weight of 362.60 g/mol. Its IUPAC name is 10-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]decan-1-ol.
Molecular Properties
| Compound Name | 10-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]decan-1-ol |
| PubChem CID | 131752352 |
| Molecular Formula | C24H42O2 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.32 |
| IUPAC Name | 10-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]decan-1-ol |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(OCCCCCCCCCCO)cc1 |
| InChI | InChI=1S/C24H42O2/c1-23(2,3)20-24(4,5)21-14-16-22(17-15-21)26-19-13-11-9-7-6-8-10-12-18-25/h14-17,25H,6-13,18-20H2,1-5H3 |
| InChIKey | YHBHQYRDAVETGQ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]decan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]decan-1-ol?
The IUPAC name of 10-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]decan-1-ol (CID 131752352) is 10-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]decan-1-ol.
What is the SMILES notation for 10-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]decan-1-ol?
The canonical SMILES for 10-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]decan-1-ol is CC(C)(C)CC(C)(C)c1ccc(OCCCCCCCCCCO)cc1.
What is the InChIKey of 10-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]decan-1-ol?
The InChIKey is YHBHQYRDAVETGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H42O2/c1-23(2,3)20-24(4,5)21-14-16-22(17-15-21)26-19-13-11-9-7-6-8-10-12-18-25/h14-17,25H,6-13,18-20H2,1-5H3.
What are the key properties of 10-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]decan-1-ol?
10-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]decan-1-ol has a molecular weight of 362.60 g/mol, XLogP of 6.89, 13 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]decan-1-ol is sourced from PubChem (CID 131752352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).