About [(E)-15-hydroxyheptadec-9-en-11,13-diyn-8-yl] acetate
[(E)-15-hydroxyheptadec-9-en-11,13-diyn-8-yl] acetate (PubChem CID 131752713) has the molecular formula C19H28O3
and a molecular weight of 304.43 g/mol. Its IUPAC name is [(E)-15-hydroxyheptadec-9-en-11,13-diyn-8-yl] acetate.
Molecular Properties
| Compound Name | [(E)-15-hydroxyheptadec-9-en-11,13-diyn-8-yl] acetate |
| PubChem CID | 131752713 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | [(E)-15-hydroxyheptadec-9-en-11,13-diyn-8-yl] acetate |
| SMILES | CCCCCCCC(/C=C/C#CC#CC(O)CC)OC(C)=O |
| InChI | InChI=1S/C19H28O3/c1-4-6-7-8-12-15-19(22-17(3)20)16-13-10-9-11-14-18(21)5-2/h13,16,18-19,21H,4-8,12,15H2,1-3H3/b16-13+ |
| InChIKey | AUQPBBOKCAROLF-DTQAZKPQSA-N |
| XLogP | 3.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-15-hydroxyheptadec-9-en-11,13-diyn-8-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-15-hydroxyheptadec-9-en-11,13-diyn-8-yl] acetate?
The IUPAC name of [(E)-15-hydroxyheptadec-9-en-11,13-diyn-8-yl] acetate (CID 131752713) is [(E)-15-hydroxyheptadec-9-en-11,13-diyn-8-yl] acetate.
What is the SMILES notation for [(E)-15-hydroxyheptadec-9-en-11,13-diyn-8-yl] acetate?
The canonical SMILES for [(E)-15-hydroxyheptadec-9-en-11,13-diyn-8-yl] acetate is CCCCCCCC(/C=C/C#CC#CC(O)CC)OC(C)=O.
What is the InChIKey of [(E)-15-hydroxyheptadec-9-en-11,13-diyn-8-yl] acetate?
The InChIKey is AUQPBBOKCAROLF-DTQAZKPQSA-N. The full InChI is InChI=1S/C19H28O3/c1-4-6-7-8-12-15-19(22-17(3)20)16-13-10-9-11-14-18(21)5-2/h13,16,18-19,21H,4-8,12,15H2,1-3H3/b16-13+.
What are the key properties of [(E)-15-hydroxyheptadec-9-en-11,13-diyn-8-yl] acetate?
[(E)-15-hydroxyheptadec-9-en-11,13-diyn-8-yl] acetate has a molecular weight of 304.43 g/mol, XLogP of 3.61, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-15-hydroxyheptadec-9-en-11,13-diyn-8-yl] acetate is sourced from PubChem (CID 131752713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).