C17H22O2 — CID 131752714
(8E,10E)-heptadeca-1,8,10-trien-4,6-diyne-3,12-diol (PubChem CID 131752714) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is (8E,10E)-heptadeca-1,8,10-trien-4,6-diyne-3,12-diol.
| Compound Name | (8E,10E)-heptadeca-1,8,10-trien-4,6-diyne-3,12-diol |
|---|---|
| PubChem CID | 131752714 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (8E,10E)-heptadeca-1,8,10-trien-4,6-diyne-3,12-diol |
| SMILES | C=CC(O)C#CC#C/C=C/C=C/C(O)CCCCC |
| InChI | InChI=1S/C17H22O2/c1-3-5-10-14-17(19)15-12-9-7-6-8-11-13-16(18)4-2/h4,7,9,12,15-19H,2-3,5,10,14H2,1H3/b9-7+,15-12+ |
| InChIKey | ADJNQGJVAJRCCO-KDFHGORWSA-N |
| XLogP | 2.59 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|