About [(1E)-1-(3-oxo-6,7-dihydro-2-benzofuran-1-ylidene)butan-2-yl] (E)-2-methylbut-2-enoate
[(1E)-1-(3-oxo-6,7-dihydro-2-benzofuran-1-ylidene)butan-2-yl] (E)-2-methylbut-2-enoate (PubChem CID 131752734) has the molecular formula C17H20O4
and a molecular weight of 288.34 g/mol. Its IUPAC name is [(1E)-1-(3-oxo-6,7-dihydro-2-benzofuran-1-ylidene)butan-2-yl] (E)-2-methylbut-2-enoate.
Molecular Properties
| Compound Name | [(1E)-1-(3-oxo-6,7-dihydro-2-benzofuran-1-ylidene)butan-2-yl] (E)-2-methylbut-2-enoate |
| PubChem CID | 131752734 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | [(1E)-1-(3-oxo-6,7-dihydro-2-benzofuran-1-ylidene)butan-2-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)OC(/C=C1/OC(=O)C2=C1CCC=C2)CC |
| InChI | InChI=1S/C17H20O4/c1-4-11(3)16(18)20-12(5-2)10-15-13-8-6-7-9-14(13)17(19)21-15/h4,7,9-10,12H,5-6,8H2,1-3H3/b11-4+,15-10+ |
| InChIKey | JZZIVNUYKVAAGC-JZFHRPHZSA-N |
| XLogP | 3.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(1E)-1-(3-oxo-6,7-dihydro-2-benzofuran-1-ylidene)butan-2-yl] (E)-2-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1E)-1-(3-oxo-6,7-dihydro-2-benzofuran-1-ylidene)butan-2-yl] (E)-2-methylbut-2-enoate?
The IUPAC name of [(1E)-1-(3-oxo-6,7-dihydro-2-benzofuran-1-ylidene)butan-2-yl] (E)-2-methylbut-2-enoate (CID 131752734) is [(1E)-1-(3-oxo-6,7-dihydro-2-benzofuran-1-ylidene)butan-2-yl] (E)-2-methylbut-2-enoate.
What is the SMILES notation for [(1E)-1-(3-oxo-6,7-dihydro-2-benzofuran-1-ylidene)butan-2-yl] (E)-2-methylbut-2-enoate?
The canonical SMILES for [(1E)-1-(3-oxo-6,7-dihydro-2-benzofuran-1-ylidene)butan-2-yl] (E)-2-methylbut-2-enoate is C/C=C(\C)C(=O)OC(/C=C1/OC(=O)C2=C1CCC=C2)CC.
What is the InChIKey of [(1E)-1-(3-oxo-6,7-dihydro-2-benzofuran-1-ylidene)butan-2-yl] (E)-2-methylbut-2-enoate?
The InChIKey is JZZIVNUYKVAAGC-JZFHRPHZSA-N. The full InChI is InChI=1S/C17H20O4/c1-4-11(3)16(18)20-12(5-2)10-15-13-8-6-7-9-14(13)17(19)21-15/h4,7,9-10,12H,5-6,8H2,1-3H3/b11-4+,15-10+.
What are the key properties of [(1E)-1-(3-oxo-6,7-dihydro-2-benzofuran-1-ylidene)butan-2-yl] (E)-2-methylbut-2-enoate?
[(1E)-1-(3-oxo-6,7-dihydro-2-benzofuran-1-ylidene)butan-2-yl] (E)-2-methylbut-2-enoate has a molecular weight of 288.34 g/mol, XLogP of 3.36, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1E)-1-(3-oxo-6,7-dihydro-2-benzofuran-1-ylidene)butan-2-yl] (E)-2-methylbut-2-enoate is sourced from PubChem (CID 131752734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).