About [5-[(Z)-2,3-dihydropyrrol-4-ylidenemethyl]furan-2-yl]methanol
[5-[(Z)-2,3-dihydropyrrol-4-ylidenemethyl]furan-2-yl]methanol (PubChem CID 131752775) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is [5-[(Z)-2,3-dihydropyrrol-4-ylidenemethyl]furan-2-yl]methanol.
Molecular Properties
| Compound Name | [5-[(Z)-2,3-dihydropyrrol-4-ylidenemethyl]furan-2-yl]methanol |
| PubChem CID | 131752775 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | [5-[(Z)-2,3-dihydropyrrol-4-ylidenemethyl]furan-2-yl]methanol |
| SMILES | OCc1ccc(/C=C2\C=NCC2)o1 |
| InChI | InChI=1S/C10H11NO2/c12-7-10-2-1-9(13-10)5-8-3-4-11-6-8/h1-2,5-6,12H,3-4,7H2/b8-5- |
| InChIKey | JOWOWIZUAITHGQ-YVMONPNESA-N |
| XLogP | 1.63 |
| TPSA | 45.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-[(Z)-2,3-dihydropyrrol-4-ylidenemethyl]furan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(Z)-2,3-dihydropyrrol-4-ylidenemethyl]furan-2-yl]methanol?
The IUPAC name of [5-[(Z)-2,3-dihydropyrrol-4-ylidenemethyl]furan-2-yl]methanol (CID 131752775) is [5-[(Z)-2,3-dihydropyrrol-4-ylidenemethyl]furan-2-yl]methanol.
What is the SMILES notation for [5-[(Z)-2,3-dihydropyrrol-4-ylidenemethyl]furan-2-yl]methanol?
The canonical SMILES for [5-[(Z)-2,3-dihydropyrrol-4-ylidenemethyl]furan-2-yl]methanol is OCc1ccc(/C=C2\C=NCC2)o1.
What is the InChIKey of [5-[(Z)-2,3-dihydropyrrol-4-ylidenemethyl]furan-2-yl]methanol?
The InChIKey is JOWOWIZUAITHGQ-YVMONPNESA-N. The full InChI is InChI=1S/C10H11NO2/c12-7-10-2-1-9(13-10)5-8-3-4-11-6-8/h1-2,5-6,12H,3-4,7H2/b8-5-.
What are the key properties of [5-[(Z)-2,3-dihydropyrrol-4-ylidenemethyl]furan-2-yl]methanol?
[5-[(Z)-2,3-dihydropyrrol-4-ylidenemethyl]furan-2-yl]methanol has a molecular weight of 177.20 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(Z)-2,3-dihydropyrrol-4-ylidenemethyl]furan-2-yl]methanol is sourced from PubChem (CID 131752775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).