About (E)-tetracos-20-ene-1,18-diol
(E)-tetracos-20-ene-1,18-diol (PubChem CID 131752970) has the molecular formula C24H48O2
and a molecular weight of 368.65 g/mol. Its IUPAC name is (E)-tetracos-20-ene-1,18-diol.
Molecular Properties
| Compound Name | (E)-tetracos-20-ene-1,18-diol |
| PubChem CID | 131752970 |
| Molecular Formula | C24H48O2 |
| Molecular Weight | 368.65 g/mol |
| Exact Mass | 368.37 |
| IUPAC Name | (E)-tetracos-20-ene-1,18-diol |
| SMILES | CCC/C=C/CC(O)CCCCCCCCCCCCCCCCCO |
| InChI | InChI=1S/C24H48O2/c1-2-3-4-18-21-24(26)22-19-16-14-12-10-8-6-5-7-9-11-13-15-17-20-23-25/h4,18,24-26H,2-3,5-17,19-23H2,1H3/b18-4+ |
| InChIKey | JYZDOSWMZPZDMV-JJPRUIFNSA-N |
| XLogP | 7.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.65 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-tetracos-20-ene-1,18-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-tetracos-20-ene-1,18-diol?
The IUPAC name of (E)-tetracos-20-ene-1,18-diol (CID 131752970) is (E)-tetracos-20-ene-1,18-diol.
What is the SMILES notation for (E)-tetracos-20-ene-1,18-diol?
The canonical SMILES for (E)-tetracos-20-ene-1,18-diol is CCC/C=C/CC(O)CCCCCCCCCCCCCCCCCO.
What is the InChIKey of (E)-tetracos-20-ene-1,18-diol?
The InChIKey is JYZDOSWMZPZDMV-JJPRUIFNSA-N. The full InChI is InChI=1S/C24H48O2/c1-2-3-4-18-21-24(26)22-19-16-14-12-10-8-6-5-7-9-11-13-15-17-20-23-25/h4,18,24-26H,2-3,5-17,19-23H2,1H3/b18-4+.
What are the key properties of (E)-tetracos-20-ene-1,18-diol?
(E)-tetracos-20-ene-1,18-diol has a molecular weight of 368.65 g/mol, XLogP of 7.33, 21 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-tetracos-20-ene-1,18-diol is sourced from PubChem (CID 131752970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).