About (E)-25-methyltritriacont-21-ene-1,9,11-triol
(E)-25-methyltritriacont-21-ene-1,9,11-triol (PubChem CID 131753012) has the molecular formula C34H68O3
and a molecular weight of 524.92 g/mol. Its IUPAC name is (E)-25-methyltritriacont-21-ene-1,9,11-triol.
Molecular Properties
| Compound Name | (E)-25-methyltritriacont-21-ene-1,9,11-triol |
| PubChem CID | 131753012 |
| Molecular Formula | C34H68O3 |
| Molecular Weight | 524.92 g/mol |
| Exact Mass | 524.52 |
| IUPAC Name | (E)-25-methyltritriacont-21-ene-1,9,11-triol |
| SMILES | CCCCCCCCC(C)CC/C=C/CCCCCCCCCC(O)CC(O)CCCCCCCCO |
| InChI | InChI=1S/C34H68O3/c1-3-4-5-6-16-21-26-32(2)27-22-17-12-10-8-7-9-11-13-18-23-28-33(36)31-34(37)29-24-19-14-15-20-25-30-35/h12,17,32-37H,3-11,13-16,18-31H2,1-2H3/b17-12+ |
| InChIKey | BOYBJOZTRHQFNM-SFQUDFHCSA-N |
| XLogP | 10.06 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.92 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-25-methyltritriacont-21-ene-1,9,11-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-25-methyltritriacont-21-ene-1,9,11-triol?
The IUPAC name of (E)-25-methyltritriacont-21-ene-1,9,11-triol (CID 131753012) is (E)-25-methyltritriacont-21-ene-1,9,11-triol.
What is the SMILES notation for (E)-25-methyltritriacont-21-ene-1,9,11-triol?
The canonical SMILES for (E)-25-methyltritriacont-21-ene-1,9,11-triol is CCCCCCCCC(C)CC/C=C/CCCCCCCCCC(O)CC(O)CCCCCCCCO.
What is the InChIKey of (E)-25-methyltritriacont-21-ene-1,9,11-triol?
The InChIKey is BOYBJOZTRHQFNM-SFQUDFHCSA-N. The full InChI is InChI=1S/C34H68O3/c1-3-4-5-6-16-21-26-32(2)27-22-17-12-10-8-7-9-11-13-18-23-28-33(36)31-34(37)29-24-19-14-15-20-25-30-35/h12,17,32-37H,3-11,13-16,18-31H2,1-2H3/b17-12+.
What are the key properties of (E)-25-methyltritriacont-21-ene-1,9,11-triol?
(E)-25-methyltritriacont-21-ene-1,9,11-triol has a molecular weight of 524.92 g/mol, XLogP of 10.06, 30 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-25-methyltritriacont-21-ene-1,9,11-triol is sourced from PubChem (CID 131753012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).