C35H54O2 — CID 131753057
[(9E)-heptadeca-1,9-dien-4,6-diyn-3-yl] (9E,12Z)-octadeca-9,12-dienoate (PubChem CID 131753057) has the molecular formula C35H54O2 and a molecular weight of 506.82 g/mol. Its IUPAC name is [(9E)-heptadeca-1,9-dien-4,6-diyn-3-yl] (9E,12Z)-octadeca-9,12-dienoate.
| Compound Name | [(9E)-heptadeca-1,9-dien-4,6-diyn-3-yl] (9E,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 131753057 |
| Molecular Formula | C35H54O2 |
| Molecular Weight | 506.82 g/mol |
| Exact Mass | 506.41 |
| IUPAC Name | [(9E)-heptadeca-1,9-dien-4,6-diyn-3-yl] (9E,12Z)-octadeca-9,12-dienoate |
| SMILES | C=CC(C#CC#CC/C=C/CCCCCCC)OC(=O)CCCCCCC/C=C/C/C=C\CCCCC |
| InChI | InChI=1S/C35H54O2/c1-4-7-9-11-13-15-17-19-20-21-23-25-27-29-31-33-35(36)37-34(6-3)32-30-28-26-24-22-18-16-14-12-10-8-5-2/h6,13,15,18-20,22,34H,3-5,7-12,14,16-17,21,23-25,27,29,31,33H2,1-2H3/b15-13-,20-19+,22-18+ |
| InChIKey | QALUBIVHAOUQRD-XEJKXIQKSA-N |
| XLogP | 10.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.82 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|