C16H28O10 — CID 131753120
2-(3-methylbut-2-enoxy)-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxane-3,4,5-triol (PubChem CID 131753120) has the molecular formula C16H28O10 and a molecular weight of 380.39 g/mol. Its IUPAC name is 2-(3-methylbut-2-enoxy)-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxane-3,4,5-triol.
| Compound Name | 2-(3-methylbut-2-enoxy)-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 131753120 |
| Molecular Formula | C16H28O10 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-(3-methylbut-2-enoxy)-6-[(3,4,5-trihydroxyoxan-2-yl)oxymethyl]oxane-3,4,5-triol |
| SMILES | CC(C)=CCOC1OC(COC2OCC(O)C(O)C2O)C(O)C(O)C1O |
| InChI | InChI=1S/C16H28O10/c1-7(2)3-4-23-16-14(22)12(20)11(19)9(26-16)6-25-15-13(21)10(18)8(17)5-24-15/h3,8-22H,4-6H2,1-2H3 |
| InChIKey | NYSQQJIJJJAWCE-UHFFFAOYSA-N |
| XLogP | -2.77 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|