About 4-chloro-2-(2,4-dimethoxyphenyl)-1H-imidazo[4,5-c]pyridine
4-chloro-2-(2,4-dimethoxyphenyl)-1H-imidazo[4,5-c]pyridine (PubChem CID 13175389) has the molecular formula C14H12ClN3O2
and a molecular weight of 289.72 g/mol. Its IUPAC name is 4-chloro-2-(2,4-dimethoxyphenyl)-1H-imidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 4-chloro-2-(2,4-dimethoxyphenyl)-1H-imidazo[4,5-c]pyridine |
| PubChem CID | 13175389 |
| Molecular Formula | C14H12ClN3O2 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 4-chloro-2-(2,4-dimethoxyphenyl)-1H-imidazo[4,5-c]pyridine |
| SMILES | COc1ccc(-c2nc3c(Cl)nccc3[nH]2)c(OC)c1 |
| InChI | InChI=1S/C14H12ClN3O2/c1-19-8-3-4-9(11(7-8)20-2)14-17-10-5-6-16-13(15)12(10)18-14/h3-7H,1-2H3,(H,17,18) |
| InChIKey | SSQASBLMKALSGB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-(2,4-dimethoxyphenyl)-1H-imidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-(2,4-dimethoxyphenyl)-1H-imidazo[4,5-c]pyridine?
The IUPAC name of 4-chloro-2-(2,4-dimethoxyphenyl)-1H-imidazo[4,5-c]pyridine (CID 13175389) is 4-chloro-2-(2,4-dimethoxyphenyl)-1H-imidazo[4,5-c]pyridine.
What is the SMILES notation for 4-chloro-2-(2,4-dimethoxyphenyl)-1H-imidazo[4,5-c]pyridine?
The canonical SMILES for 4-chloro-2-(2,4-dimethoxyphenyl)-1H-imidazo[4,5-c]pyridine is COc1ccc(-c2nc3c(Cl)nccc3[nH]2)c(OC)c1.
What is the InChIKey of 4-chloro-2-(2,4-dimethoxyphenyl)-1H-imidazo[4,5-c]pyridine?
The InChIKey is SSQASBLMKALSGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClN3O2/c1-19-8-3-4-9(11(7-8)20-2)14-17-10-5-6-16-13(15)12(10)18-14/h3-7H,1-2H3,(H,17,18).
What are the key properties of 4-chloro-2-(2,4-dimethoxyphenyl)-1H-imidazo[4,5-c]pyridine?
4-chloro-2-(2,4-dimethoxyphenyl)-1H-imidazo[4,5-c]pyridine has a molecular weight of 289.72 g/mol, XLogP of 3.30, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-(2,4-dimethoxyphenyl)-1H-imidazo[4,5-c]pyridine is sourced from PubChem (CID 13175389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).