About N-[(2-methyl-1,3-dioxolan-2-yl)methyl]ethanamine
N-[(2-methyl-1,3-dioxolan-2-yl)methyl]ethanamine (PubChem CID 13175522) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is N-[(2-methyl-1,3-dioxolan-2-yl)methyl]ethanamine.
Molecular Properties
| Compound Name | N-[(2-methyl-1,3-dioxolan-2-yl)methyl]ethanamine |
| PubChem CID | 13175522 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | N-[(2-methyl-1,3-dioxolan-2-yl)methyl]ethanamine |
| SMILES | CCNCC1(C)OCCO1 |
| InChI | InChI=1S/C7H15NO2/c1-3-8-6-7(2)9-4-5-10-7/h8H,3-6H2,1-2H3 |
| InChIKey | YMRPWLLTVHZUFP-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2-methyl-1,3-dioxolan-2-yl)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-methyl-1,3-dioxolan-2-yl)methyl]ethanamine?
The IUPAC name of N-[(2-methyl-1,3-dioxolan-2-yl)methyl]ethanamine (CID 13175522) is N-[(2-methyl-1,3-dioxolan-2-yl)methyl]ethanamine.
What is the SMILES notation for N-[(2-methyl-1,3-dioxolan-2-yl)methyl]ethanamine?
The canonical SMILES for N-[(2-methyl-1,3-dioxolan-2-yl)methyl]ethanamine is CCNCC1(C)OCCO1.
What is the InChIKey of N-[(2-methyl-1,3-dioxolan-2-yl)methyl]ethanamine?
The InChIKey is YMRPWLLTVHZUFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2/c1-3-8-6-7(2)9-4-5-10-7/h8H,3-6H2,1-2H3.
What are the key properties of N-[(2-methyl-1,3-dioxolan-2-yl)methyl]ethanamine?
N-[(2-methyl-1,3-dioxolan-2-yl)methyl]ethanamine has a molecular weight of 145.20 g/mol, XLogP of 0.36, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-methyl-1,3-dioxolan-2-yl)methyl]ethanamine is sourced from PubChem (CID 13175522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).