C53H92O6 — CID 131759420
[(2S)-2,3-bis[[(Z)-hexadec-9-enoyl]oxy]propyl] (6Z,9Z,12Z)-octadeca-6,9,12-trienoate (PubChem CID 131759420) has the molecular formula C53H92O6 and a molecular weight of 825.31 g/mol. Its IUPAC name is [(2S)-2,3-bis[[(Z)-hexadec-9-enoyl]oxy]propyl] (6Z,9Z,12Z)-octadeca-6,9,12-trienoate.
| Compound Name | [(2S)-2,3-bis[[(Z)-hexadec-9-enoyl]oxy]propyl] (6Z,9Z,12Z)-octadeca-6,9,12-trienoate |
|---|---|
| PubChem CID | 131759420 |
| Molecular Formula | C53H92O6 |
| Molecular Weight | 825.31 g/mol |
| Exact Mass | 824.69 |
| IUPAC Name | [(2S)-2,3-bis[[(Z)-hexadec-9-enoyl]oxy]propyl] (6Z,9Z,12Z)-octadeca-6,9,12-trienoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)OC[C@H](COC(=O)CCCCCCC/C=C\CCCCCC)OC(=O)CCCCCCC/C=C\CCCCCC |
| InChI | InChI=1S/C53H92O6/c1-4-7-10-13-16-19-22-25-26-29-31-34-37-40-43-46-52(55)58-49-50(59-53(56)47-44-41-38-35-32-28-24-21-18-15-12-9-6-3)48-57-51(54)45-42-39-36-33-30-27-23-20-17-14-11-8-5-2/h16,19-21,23-26,31,34,50H,4-15,17-18,22,27-30,32-33,35-49H2,1-3H3/b19-16-,23-20-,24-21-,26-25-,34-31-/t50-/m0/s1 |
| InChIKey | CWAFIVPCBLPYIH-DLARYPMJSA-N |
| XLogP | 16.09 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.31 |
| LogP ≤ 5 | 16.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|