C57H94O6 — CID 131759431
[(2S)-2,3-bis[[(Z)-hexadec-9-enoyl]oxy]propyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 131759431) has the molecular formula C57H94O6 and a molecular weight of 875.37 g/mol. Its IUPAC name is [(2S)-2,3-bis[[(Z)-hexadec-9-enoyl]oxy]propyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | [(2S)-2,3-bis[[(Z)-hexadec-9-enoyl]oxy]propyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 131759431 |
| Molecular Formula | C57H94O6 |
| Molecular Weight | 875.37 g/mol |
| Exact Mass | 874.71 |
| IUPAC Name | [(2S)-2,3-bis[[(Z)-hexadec-9-enoyl]oxy]propyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC[C@H](COC(=O)CCCCCCC/C=C\CCCCCC)OC(=O)CCCCCCC/C=C\CCCCCC |
| InChI | InChI=1S/C57H94O6/c1-4-7-10-13-16-19-22-25-26-27-28-29-30-33-35-38-41-44-47-50-56(59)62-53-54(63-57(60)51-48-45-42-39-36-32-24-21-18-15-12-9-6-3)52-61-55(58)49-46-43-40-37-34-31-23-20-17-14-11-8-5-2/h7,10,16,19-21,23-26,28-29,33,35,41,44,54H,4-6,8-9,11-15,17-18,22,27,30-32,34,36-40,42-43,45-53H2,1-3H3/b10-7-,19-16-,23-20-,24-21-,26-25-,29-28-,35-33-,44-41-/t54-/m0/s1 |
| InChIKey | JJKLAPRFAPRJOG-LTVYIXHASA-N |
| XLogP | 16.98 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 45 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.37 |
| LogP ≤ 5 | 16.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|