C65H104O6 — CID 131761826
[(2S)-2,3-bis[[(5Z,8Z,11Z)-icosa-5,8,11-trienoyl]oxy]propyl] (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate (PubChem CID 131761826) has the molecular formula C65H104O6 and a molecular weight of 981.54 g/mol. Its IUPAC name is [(2S)-2,3-bis[[(5Z,8Z,11Z)-icosa-5,8,11-trienoyl]oxy]propyl] (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate.
| Compound Name | [(2S)-2,3-bis[[(5Z,8Z,11Z)-icosa-5,8,11-trienoyl]oxy]propyl] (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate |
|---|---|
| PubChem CID | 131761826 |
| Molecular Formula | C65H104O6 |
| Molecular Weight | 981.54 g/mol |
| Exact Mass | 980.78 |
| IUPAC Name | [(2S)-2,3-bis[[(5Z,8Z,11Z)-icosa-5,8,11-trienoyl]oxy]propyl] (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC[C@H](COC(=O)CCC/C=C\C/C=C\C/C=C\CCCCCCCC)OC(=O)CCC/C=C\C/C=C\C/C=C\CCCCCCCC |
| InChI | InChI=1S/C65H104O6/c1-4-7-10-13-16-19-22-25-28-31-32-35-37-40-43-46-49-52-55-58-64(67)70-61-62(71-65(68)59-56-53-50-47-44-41-38-34-30-27-24-21-18-15-12-9-6-3)60-69-63(66)57-54-51-48-45-42-39-36-33-29-26-23-20-17-14-11-8-5-2/h16,19,25-30,32,35-36,38-41,43,45,47-50,52,62H,4-15,17-18,20-24,31,33-34,37,42,44,46,51,53-61H2,1-3H3/b19-16-,28-25-,29-26-,30-27-,35-32-,39-36-,41-38-,43-40-,48-45-,50-47-,52-49-/t62-/m0/s1 |
| InChIKey | GOMWYYIOHUUNDY-DWUFDDORSA-N |
| XLogP | 19.43 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 981.54 |
| LogP ≤ 5 | 19.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|