C65H102O6 — CID 131762104
1,3-bis[[(5Z,8Z,11Z)-icosa-5,8,11-trienoyl]oxy]propan-2-yl (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 131762104) has the molecular formula C65H102O6 and a molecular weight of 979.52 g/mol. Its IUPAC name is 1,3-bis[[(5Z,8Z,11Z)-icosa-5,8,11-trienoyl]oxy]propan-2-yl (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | 1,3-bis[[(5Z,8Z,11Z)-icosa-5,8,11-trienoyl]oxy]propan-2-yl (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 131762104 |
| Molecular Formula | C65H102O6 |
| Molecular Weight | 979.52 g/mol |
| Exact Mass | 978.77 |
| IUPAC Name | 1,3-bis[[(5Z,8Z,11Z)-icosa-5,8,11-trienoyl]oxy]propan-2-yl (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC(COC(=O)CCC/C=C\C/C=C\C/C=C\CCCCCCCC)COC(=O)CCC/C=C\C/C=C\C/C=C\CCCCCCCC |
| InChI | InChI=1S/C65H102O6/c1-4-7-10-13-16-19-22-25-28-31-32-35-38-41-44-47-50-53-56-59-65(68)71-62(60-69-63(66)57-54-51-48-45-42-39-36-33-29-26-23-20-17-14-11-8-5-2)61-70-64(67)58-55-52-49-46-43-40-37-34-30-27-24-21-18-15-12-9-6-3/h7,10,16,19,25-30,32,35-37,39-41,44-46,48-50,53,62H,4-6,8-9,11-15,17-18,20-24,31,33-34,38,42-43,47,51-52,54-61H2,1-3H3/b10-7-,19-16-,28-25-,29-26-,30-27-,35-32-,39-36-,40-37-,44-41-,48-45-,49-46-,53-50- |
| InChIKey | WBTOGGRLPHBVAX-BNQPMTHSSA-N |
| XLogP | 19.20 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 979.52 |
| LogP ≤ 5 | 19.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|