C59H96O6 — CID 131763664
1,3-bis[[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxy]propan-2-yl (5Z,8Z,11Z)-icosa-5,8,11-trienoate (PubChem CID 131763664) has the molecular formula C59H96O6 and a molecular weight of 901.41 g/mol. Its IUPAC name is 1,3-bis[[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxy]propan-2-yl (5Z,8Z,11Z)-icosa-5,8,11-trienoate.
| Compound Name | 1,3-bis[[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxy]propan-2-yl (5Z,8Z,11Z)-icosa-5,8,11-trienoate |
|---|---|
| PubChem CID | 131763664 |
| Molecular Formula | C59H96O6 |
| Molecular Weight | 901.41 g/mol |
| Exact Mass | 900.72 |
| IUPAC Name | 1,3-bis[[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxy]propan-2-yl (5Z,8Z,11Z)-icosa-5,8,11-trienoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)OCC(COC(=O)CCCC/C=C\C/C=C\C/C=C\CCCCC)OC(=O)CCC/C=C\C/C=C\C/C=C\CCCCCCCC |
| InChI | InChI=1S/C59H96O6/c1-4-7-10-13-16-19-22-25-28-29-32-35-38-41-44-47-50-53-59(62)65-56(54-63-57(60)51-48-45-42-39-36-33-30-26-23-20-17-14-11-8-5-2)55-64-58(61)52-49-46-43-40-37-34-31-27-24-21-18-15-12-9-6-3/h17-18,20-21,25-28,30-32,35-37,39-41,44,56H,4-16,19,22-24,29,33-34,38,42-43,45-55H2,1-3H3/b20-17-,21-18-,28-25-,30-26-,31-27-,35-32-,39-36-,40-37-,44-41- |
| InChIKey | RIMOQAPPBXQQSU-SRTOXPGRSA-N |
| XLogP | 17.53 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.41 |
| LogP ≤ 5 | 17.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|