C23H34O3 — CID 131769828
(3S)-3-[(1S,3aR,4E,7aS)-4-[(2E)-2-[(3R,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butanal (PubChem CID 131769828) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is (3S)-3-[(1S,3aR,4E,7aS)-4-[(2E)-2-[(3R,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butanal.
| Compound Name | (3S)-3-[(1S,3aR,4E,7aS)-4-[(2E)-2-[(3R,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butanal |
|---|---|
| PubChem CID | 131769828 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (3S)-3-[(1S,3aR,4E,7aS)-4-[(2E)-2-[(3R,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butanal |
| SMILES | C=C1/C(=C/C=C2\CCC[C@]3(C)[C@@H]2CC[C@H]3[C@@H](C)CC=O)C[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C23H34O3/c1-15(10-12-24)20-8-9-21-17(5-4-11-23(20,21)3)6-7-18-13-19(25)14-22(26)16(18)2/h6-7,12,15,19-22,25-26H,2,4-5,8-11,13-14H2,1,3H3/b17-6+,18-7+/t15-,19+,20-,21+,22+,23-/m0/s1 |
| InChIKey | AOVGFTJYESGAEA-ZSCXDZJGSA-N |
| XLogP | 4.35 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|