C24H42O10 — CID 131769830
(2S,3R,4S,5S,6S)-6-[(Z,6S,7S)-17-carboxy-6-hydroxyheptadec-9-en-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 131769830) has the molecular formula C24H42O10 and a molecular weight of 490.59 g/mol. Its IUPAC name is (2S,3R,4S,5S,6S)-6-[(Z,6S,7S)-17-carboxy-6-hydroxyheptadec-9-en-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3R,4S,5S,6S)-6-[(Z,6S,7S)-17-carboxy-6-hydroxyheptadec-9-en-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 131769830 |
| Molecular Formula | C24H42O10 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | (2S,3R,4S,5S,6S)-6-[(Z,6S,7S)-17-carboxy-6-hydroxyheptadec-9-en-7-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CCCCC[C@H](O)[C@H](C/C=C\CCCCCCCC(=O)O)O[C@H]1O[C@H](C(=O)O)[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H42O10/c1-2-3-10-13-16(25)17(14-11-8-6-4-5-7-9-12-15-18(26)27)33-24-21(30)19(28)20(29)22(34-24)23(31)32/h8,11,16-17,19-22,24-25,28-30H,2-7,9-10,12-15H2,1H3,(H,26,27)(H,31,32)/b11-8-/t16-,17-,19-,20+,21-,22-,24-/m0/s1 |
| InChIKey | WDJRXGFYLUIKBX-GRIBZEQKSA-N |
| XLogP | 1.97 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|