About ethyl 2-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate
ethyl 2-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate (PubChem CID 13177584) has the molecular formula C13H12N2O5S
and a molecular weight of 308.32 g/mol. Its IUPAC name is ethyl 2-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate.
Molecular Properties
| Compound Name | ethyl 2-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate |
| PubChem CID | 13177584 |
| Molecular Formula | C13H12N2O5S |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | ethyl 2-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1nc(-c2ccc(O)c(O)c2)cs1 |
| InChI | InChI=1S/C13H12N2O5S/c1-2-20-12(19)11(18)15-13-14-8(6-21-13)7-3-4-9(16)10(17)5-7/h3-6,16-17H,2H2,1H3,(H,14,15,18) |
| InChIKey | CELDFZDWARLCAF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate?
The IUPAC name of ethyl 2-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate (CID 13177584) is ethyl 2-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate.
What is the SMILES notation for ethyl 2-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate?
The canonical SMILES for ethyl 2-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate is CCOC(=O)C(=O)Nc1nc(-c2ccc(O)c(O)c2)cs1.
What is the InChIKey of ethyl 2-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate?
The InChIKey is CELDFZDWARLCAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O5S/c1-2-20-12(19)11(18)15-13-14-8(6-21-13)7-3-4-9(16)10(17)5-7/h3-6,16-17H,2H2,1H3,(H,14,15,18).
What are the key properties of ethyl 2-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate?
ethyl 2-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate has a molecular weight of 308.32 g/mol, XLogP of 1.72, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetate is sourced from PubChem (CID 13177584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).