C13H15N3O6S — CID 13177628
2-aminoethanol;2-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetic acid (PubChem CID 13177628) has the molecular formula C13H15N3O6S and a molecular weight of 341.35 g/mol. Its IUPAC name is 2-aminoethanol;2-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetic acid.
| Compound Name | 2-aminoethanol;2-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 13177628 |
| Molecular Formula | C13H15N3O6S |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 2-aminoethanol;2-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]amino]-2-oxoacetic acid |
| SMILES | NCCO.O=C(O)C(=O)Nc1nc(-c2ccc(O)c(O)c2)cs1 |
| InChI | InChI=1S/C11H8N2O5S.C2H7NO/c14-7-2-1-5(3-8(7)15)6-4-19-11(12-6)13-9(16)10(17)18;3-1-2-4/h1-4,14-15H,(H,17,18)(H,12,13,16);4H,1-3H2 |
| InChIKey | DMZKONQFPIQHRS-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 166.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|