C12H26N2O3 — CID 13177745
9,11-dimethyl-1,4,10-trioxa-7,13-diazacyclopentadecane (PubChem CID 13177745) has the molecular formula C12H26N2O3 and a molecular weight of 246.35 g/mol. Its IUPAC name is 9,11-dimethyl-1,4,10-trioxa-7,13-diazacyclopentadecane.
| Compound Name | 9,11-dimethyl-1,4,10-trioxa-7,13-diazacyclopentadecane |
|---|---|
| PubChem CID | 13177745 |
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | 9,11-dimethyl-1,4,10-trioxa-7,13-diazacyclopentadecane |
| SMILES | CC1CNCCOCCOCCNCC(C)O1 |
| InChI | InChI=1S/C12H26N2O3/c1-11-9-13-3-5-15-7-8-16-6-4-14-10-12(2)17-11/h11-14H,3-10H2,1-2H3 |
| InChIKey | HFJQURAEUJHNJT-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |