C16H26Br2N2O3 — CID 13177929
1,3-bis(4-bromobutyl)-5,5-diethyl-1,3-diazinane-2,4,6-trione (PubChem CID 13177929) has the molecular formula C16H26Br2N2O3 and a molecular weight of 454.20 g/mol. Its IUPAC name is 1,3-bis(4-bromobutyl)-5,5-diethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-bis(4-bromobutyl)-5,5-diethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 13177929 |
| Molecular Formula | C16H26Br2N2O3 |
| Molecular Weight | 454.20 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | 1,3-bis(4-bromobutyl)-5,5-diethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(CC)C(=O)N(CCCCBr)C(=O)N(CCCCBr)C1=O |
| InChI | InChI=1S/C16H26Br2N2O3/c1-3-16(4-2)13(21)19(11-7-5-9-17)15(23)20(14(16)22)12-8-6-10-18/h3-12H2,1-2H3 |
| InChIKey | RDRMMPPEWUIZCA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.20 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|