C8H11FN2O3 — CID 13178023
(5S,6R)-6-but-3-enoxy-5-fluoro-1,3-diazinane-2,4-dione (PubChem CID 13178023) has the molecular formula C8H11FN2O3 and a molecular weight of 202.18 g/mol. Its IUPAC name is (5S,6R)-6-but-3-enoxy-5-fluoro-1,3-diazinane-2,4-dione.
| Compound Name | (5S,6R)-6-but-3-enoxy-5-fluoro-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 13178023 |
| Molecular Formula | C8H11FN2O3 |
| Molecular Weight | 202.18 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | (5S,6R)-6-but-3-enoxy-5-fluoro-1,3-diazinane-2,4-dione |
| SMILES | C=CCCO[C@H]1NC(=O)NC(=O)[C@H]1F |
| InChI | InChI=1S/C8H11FN2O3/c1-2-3-4-14-7-5(9)6(12)10-8(13)11-7/h2,5,7H,1,3-4H2,(H2,10,11,12,13)/t5-,7-/m1/s1 |
| InChIKey | WDUDINPRYYTMSU-IYSWYEEDSA-N |
| XLogP | 0.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.18 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|