About 8-fluoro-5-methylsulfanylimidazo[2,1-b][1,3,5]benzothiadiazepine
8-fluoro-5-methylsulfanylimidazo[2,1-b][1,3,5]benzothiadiazepine (PubChem CID 13178281) has the molecular formula C11H8FN3S2
and a molecular weight of 265.34 g/mol. Its IUPAC name is 8-fluoro-5-methylsulfanylimidazo[2,1-b][1,3,5]benzothiadiazepine.
Molecular Properties
| Compound Name | 8-fluoro-5-methylsulfanylimidazo[2,1-b][1,3,5]benzothiadiazepine |
| PubChem CID | 13178281 |
| Molecular Formula | C11H8FN3S2 |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 8-fluoro-5-methylsulfanylimidazo[2,1-b][1,3,5]benzothiadiazepine |
| SMILES | CSC1=Nc2cc(F)ccc2Sc2nccn21 |
| InChI | InChI=1S/C11H8FN3S2/c1-16-11-14-8-6-7(12)2-3-9(8)17-10-13-4-5-15(10)11/h2-6H,1H3 |
| InChIKey | SSNPARAOEZNPND-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-fluoro-5-methylsulfanylimidazo[2,1-b][1,3,5]benzothiadiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-5-methylsulfanylimidazo[2,1-b][1,3,5]benzothiadiazepine?
The IUPAC name of 8-fluoro-5-methylsulfanylimidazo[2,1-b][1,3,5]benzothiadiazepine (CID 13178281) is 8-fluoro-5-methylsulfanylimidazo[2,1-b][1,3,5]benzothiadiazepine.
What is the SMILES notation for 8-fluoro-5-methylsulfanylimidazo[2,1-b][1,3,5]benzothiadiazepine?
The canonical SMILES for 8-fluoro-5-methylsulfanylimidazo[2,1-b][1,3,5]benzothiadiazepine is CSC1=Nc2cc(F)ccc2Sc2nccn21.
What is the InChIKey of 8-fluoro-5-methylsulfanylimidazo[2,1-b][1,3,5]benzothiadiazepine?
The InChIKey is SSNPARAOEZNPND-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8FN3S2/c1-16-11-14-8-6-7(12)2-3-9(8)17-10-13-4-5-15(10)11/h2-6H,1H3.
What are the key properties of 8-fluoro-5-methylsulfanylimidazo[2,1-b][1,3,5]benzothiadiazepine?
8-fluoro-5-methylsulfanylimidazo[2,1-b][1,3,5]benzothiadiazepine has a molecular weight of 265.34 g/mol, XLogP of 3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-5-methylsulfanylimidazo[2,1-b][1,3,5]benzothiadiazepine is sourced from PubChem (CID 13178281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).