About 4-(2-phenyl-1,3-oxazol-5-yl)morpholine
4-(2-phenyl-1,3-oxazol-5-yl)morpholine (PubChem CID 13179056) has the molecular formula C13H14N2O2
and a molecular weight of 230.27 g/mol. Its IUPAC name is 4-(2-phenyl-1,3-oxazol-5-yl)morpholine.
Molecular Properties
| Compound Name | 4-(2-phenyl-1,3-oxazol-5-yl)morpholine |
| PubChem CID | 13179056 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 4-(2-phenyl-1,3-oxazol-5-yl)morpholine |
| SMILES | c1ccc(-c2ncc(N3CCOCC3)o2)cc1 |
| InChI | InChI=1S/C13H14N2O2/c1-2-4-11(5-3-1)13-14-10-12(17-13)15-6-8-16-9-7-15/h1-5,10H,6-9H2 |
| InChIKey | UUAAYHZMVPUNEY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-phenyl-1,3-oxazol-5-yl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-phenyl-1,3-oxazol-5-yl)morpholine?
The IUPAC name of 4-(2-phenyl-1,3-oxazol-5-yl)morpholine (CID 13179056) is 4-(2-phenyl-1,3-oxazol-5-yl)morpholine.
What is the SMILES notation for 4-(2-phenyl-1,3-oxazol-5-yl)morpholine?
The canonical SMILES for 4-(2-phenyl-1,3-oxazol-5-yl)morpholine is c1ccc(-c2ncc(N3CCOCC3)o2)cc1.
What is the InChIKey of 4-(2-phenyl-1,3-oxazol-5-yl)morpholine?
The InChIKey is UUAAYHZMVPUNEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2/c1-2-4-11(5-3-1)13-14-10-12(17-13)15-6-8-16-9-7-15/h1-5,10H,6-9H2.
What are the key properties of 4-(2-phenyl-1,3-oxazol-5-yl)morpholine?
4-(2-phenyl-1,3-oxazol-5-yl)morpholine has a molecular weight of 230.27 g/mol, XLogP of 2.18, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-phenyl-1,3-oxazol-5-yl)morpholine is sourced from PubChem (CID 13179056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).