About N,N,2-trimethyl-1,3-oxazol-5-amine
N,N,2-trimethyl-1,3-oxazol-5-amine (PubChem CID 13179059) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is N,N,2-trimethyl-1,3-oxazol-5-amine.
Molecular Properties
| Compound Name | N,N,2-trimethyl-1,3-oxazol-5-amine |
| PubChem CID | 13179059 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | N,N,2-trimethyl-1,3-oxazol-5-amine |
| SMILES | Cc1ncc(N(C)C)o1 |
| InChI | InChI=1S/C6H10N2O/c1-5-7-4-6(9-5)8(2)3/h4H,1-3H3 |
| InChIKey | YUFWRMHLGMHOQI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N,2-trimethyl-1,3-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,2-trimethyl-1,3-oxazol-5-amine?
The IUPAC name of N,N,2-trimethyl-1,3-oxazol-5-amine (CID 13179059) is N,N,2-trimethyl-1,3-oxazol-5-amine.
What is the SMILES notation for N,N,2-trimethyl-1,3-oxazol-5-amine?
The canonical SMILES for N,N,2-trimethyl-1,3-oxazol-5-amine is Cc1ncc(N(C)C)o1.
What is the InChIKey of N,N,2-trimethyl-1,3-oxazol-5-amine?
The InChIKey is YUFWRMHLGMHOQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O/c1-5-7-4-6(9-5)8(2)3/h4H,1-3H3.
What are the key properties of N,N,2-trimethyl-1,3-oxazol-5-amine?
N,N,2-trimethyl-1,3-oxazol-5-amine has a molecular weight of 126.16 g/mol, XLogP of 1.05, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,2-trimethyl-1,3-oxazol-5-amine is sourced from PubChem (CID 13179059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).