C8H10F7N — CID 13179200
N,N-diethyl-1,3,3,3-tetrafluoro-2-(trifluoromethyl)prop-1-en-1-amine (PubChem CID 13179200) has the molecular formula C8H10F7N and a molecular weight of 253.16 g/mol. Its IUPAC name is N,N-diethyl-1,3,3,3-tetrafluoro-2-(trifluoromethyl)prop-1-en-1-amine.
| Compound Name | N,N-diethyl-1,3,3,3-tetrafluoro-2-(trifluoromethyl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 13179200 |
| Molecular Formula | C8H10F7N |
| Molecular Weight | 253.16 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | N,N-diethyl-1,3,3,3-tetrafluoro-2-(trifluoromethyl)prop-1-en-1-amine |
| SMILES | CCN(CC)C(F)=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H10F7N/c1-3-16(4-2)6(9)5(7(10,11)12)8(13,14)15/h3-4H2,1-2H3 |
| InChIKey | NNROULUNBQKCHB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.16 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|