C6H11F5OSi — CID 13179201
trimethyl(2,2,3,3,3-pentafluoropropoxy)silane (PubChem CID 13179201) has the molecular formula C6H11F5OSi and a molecular weight of 222.23 g/mol. Its IUPAC name is trimethyl(2,2,3,3,3-pentafluoropropoxy)silane.
| Compound Name | trimethyl(2,2,3,3,3-pentafluoropropoxy)silane |
|---|---|
| PubChem CID | 13179201 |
| Molecular Formula | C6H11F5OSi |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | trimethyl(2,2,3,3,3-pentafluoropropoxy)silane |
| SMILES | C[Si](C)(C)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H11F5OSi/c1-13(2,3)12-4-5(7,8)6(9,10)11/h4H2,1-3H3 |
| InChIKey | LBDRUDRFGDMEBR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|