C9Cl3F7 — CID 13179243
1,1,5-trichloro-2,2,3,3,4,6,7-heptafluoroindene (PubChem CID 13179243) has the molecular formula C9Cl3F7 and a molecular weight of 347.44 g/mol. Its IUPAC name is 1,1,5-trichloro-2,2,3,3,4,6,7-heptafluoroindene.
| Compound Name | 1,1,5-trichloro-2,2,3,3,4,6,7-heptafluoroindene |
|---|---|
| PubChem CID | 13179243 |
| Molecular Formula | C9Cl3F7 |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 345.90 |
| IUPAC Name | 1,1,5-trichloro-2,2,3,3,4,6,7-heptafluoroindene |
| SMILES | Fc1c(F)c2c(c(F)c1Cl)C(F)(F)C(F)(F)C2(Cl)Cl |
| InChI | InChI=1S/C9Cl3F7/c10-3-4(13)2-1(5(14)6(3)15)7(11,12)9(18,19)8(2,16)17 |
| InChIKey | CCFVYNNNNDMIKG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|