C14H20O2 — CID 13179340
(2R,4R,5S,6R)-2,4,5-trimethyl-6-(4-methylphenyl)-1,3-dioxane (PubChem CID 13179340) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (2R,4R,5S,6R)-2,4,5-trimethyl-6-(4-methylphenyl)-1,3-dioxane.
| Compound Name | (2R,4R,5S,6R)-2,4,5-trimethyl-6-(4-methylphenyl)-1,3-dioxane |
|---|---|
| PubChem CID | 13179340 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (2R,4R,5S,6R)-2,4,5-trimethyl-6-(4-methylphenyl)-1,3-dioxane |
| SMILES | Cc1ccc([C@@H]2O[C@H](C)O[C@H](C)[C@@H]2C)cc1 |
| InChI | InChI=1S/C14H20O2/c1-9-5-7-13(8-6-9)14-10(2)11(3)15-12(4)16-14/h5-8,10-12,14H,1-4H3/t10-,11+,12+,14+/m0/s1 |
| InChIKey | GWOBQRHNQNWAPG-FMCLSXCISA-N |
| XLogP | 3.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |