C18H36 — CID 13179773
3,4-ditert-butyl-2,2,5,5-tetramethylhex-3-ene (PubChem CID 13179773) has the molecular formula C18H36 and a molecular weight of 252.49 g/mol. Its IUPAC name is 3,4-ditert-butyl-2,2,5,5-tetramethylhex-3-ene.
| Compound Name | 3,4-ditert-butyl-2,2,5,5-tetramethylhex-3-ene |
|---|---|
| PubChem CID | 13179773 |
| Molecular Formula | C18H36 |
| Molecular Weight | 252.49 g/mol |
| Exact Mass | 252.28 |
| IUPAC Name | 3,4-ditert-butyl-2,2,5,5-tetramethylhex-3-ene |
| SMILES | CC(C)(C)C(=C(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H36/c1-15(2,3)13(16(4,5)6)14(17(7,8)9)18(10,11)12/h1-12H3 |
| InChIKey | WXTSAYDLWHISDR-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.49 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|