C15H30 — CID 13179780
3-tert-butyl-2,2,4,5,5-pentamethylhex-3-ene (PubChem CID 13179780) has the molecular formula C15H30 and a molecular weight of 210.40 g/mol. Its IUPAC name is 3-tert-butyl-2,2,4,5,5-pentamethylhex-3-ene.
| Compound Name | 3-tert-butyl-2,2,4,5,5-pentamethylhex-3-ene |
|---|---|
| PubChem CID | 13179780 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.40 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | 3-tert-butyl-2,2,4,5,5-pentamethylhex-3-ene |
| SMILES | CC(=C(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H30/c1-11(13(2,3)4)12(14(5,6)7)15(8,9)10/h1-10H3 |
| InChIKey | BEHOXZDVJJHTPY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.40 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|