2,4-dimethoxy-5-propan-2-ylsulfonylbenzenesulfonyl chloride

C11H15ClO6S2 — CID 13179810

IUPAC2,4-dimethoxy-5-propan-2-ylsulfonylbenzenesulfonyl chloride
SMILESCOc1cc(OC)c(S(=O)(=O)C(C)C)cc1S(=O)(=O)Cl
InChIInChI=1S/C11H15ClO6S2/c1-7(2)19(13,14)10-6-11(20(12,15)16)9(18-4)5-8(10)17-3/h5-7H,1-4H3
InChIKeyITVVQEQMDNDAIL-UHFFFAOYSA-N
MW342.82 g/mol
LogP1.81
Rot. Bonds5

About 2,4-dimethoxy-5-propan-2-ylsulfonylbenzenesulfonyl chloride

2,4-dimethoxy-5-propan-2-ylsulfonylbenzenesulfonyl chloride (PubChem CID 13179810) has the molecular formula C11H15ClO6S2 and a molecular weight of 342.82 g/mol. Its IUPAC name is 2,4-dimethoxy-5-propan-2-ylsulfonylbenzenesulfonyl chloride.

Molecular Properties

Compound Name2,4-dimethoxy-5-propan-2-ylsulfonylbenzenesulfonyl chloride
PubChem CID13179810
Molecular FormulaC11H15ClO6S2
Molecular Weight342.82 g/mol
Exact Mass342.00
IUPAC Name2,4-dimethoxy-5-propan-2-ylsulfonylbenzenesulfonyl chloride
SMILESCOc1cc(OC)c(S(=O)(=O)C(C)C)cc1S(=O)(=O)Cl
InChIInChI=1S/C11H15ClO6S2/c1-7(2)19(13,14)10-6-11(20(12,15)16)9(18-4)5-8(10)17-3/h5-7H,1-4H3
InChIKeyITVVQEQMDNDAIL-UHFFFAOYSA-N
XLogP1.81
TPSA86.74 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500342.82
LogP ≤ 51.81
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze 2,4-dimethoxy-5-propan-2-ylsulfonylbenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dimethoxy-5-propan-2-ylsulfonylbenzenesulfonyl chloride?
The IUPAC name of 2,4-dimethoxy-5-propan-2-ylsulfonylbenzenesulfonyl chloride (CID 13179810) is 2,4-dimethoxy-5-propan-2-ylsulfonylbenzenesulfonyl chloride.
What is the SMILES notation for 2,4-dimethoxy-5-propan-2-ylsulfonylbenzenesulfonyl chloride?
The canonical SMILES for 2,4-dimethoxy-5-propan-2-ylsulfonylbenzenesulfonyl chloride is COc1cc(OC)c(S(=O)(=O)C(C)C)cc1S(=O)(=O)Cl.
What is the InChIKey of 2,4-dimethoxy-5-propan-2-ylsulfonylbenzenesulfonyl chloride?
The InChIKey is ITVVQEQMDNDAIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClO6S2/c1-7(2)19(13,14)10-6-11(20(12,15)16)9(18-4)5-8(10)17-3/h5-7H,1-4H3.
What are the key properties of 2,4-dimethoxy-5-propan-2-ylsulfonylbenzenesulfonyl chloride?
2,4-dimethoxy-5-propan-2-ylsulfonylbenzenesulfonyl chloride has a molecular weight of 342.82 g/mol, XLogP of 1.81, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethoxy-5-propan-2-ylsulfonylbenzenesulfonyl chloride is sourced from PubChem (CID 13179810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).