About [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;hydrochloride
[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;hydrochloride (PubChem CID 131801125) has the molecular formula C11H13ClN2S
and a molecular weight of 240.76 g/mol. Its IUPAC name is [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;hydrochloride |
| PubChem CID | 131801125 |
| Molecular Formula | C11H13ClN2S |
| Molecular Weight | 240.76 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;hydrochloride |
| SMILES | Cc1ncsc1-c1ccc(CN)cc1.Cl |
| InChI | InChI=1S/C11H12N2S.ClH/c1-8-11(14-7-13-8)10-4-2-9(6-12)3-5-10;/h2-5,7H,6,12H2,1H3;1H |
| InChIKey | LPTNIIRGFCUEJT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.76 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;hydrochloride?
The IUPAC name of [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;hydrochloride (CID 131801125) is [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;hydrochloride.
What is the SMILES notation for [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;hydrochloride?
The canonical SMILES for [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;hydrochloride is Cc1ncsc1-c1ccc(CN)cc1.Cl.
What is the InChIKey of [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;hydrochloride?
The InChIKey is LPTNIIRGFCUEJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2S.ClH/c1-8-11(14-7-13-8)10-4-2-9(6-12)3-5-10;/h2-5,7H,6,12H2,1H3;1H.
What are the key properties of [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;hydrochloride?
[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;hydrochloride has a molecular weight of 240.76 g/mol, XLogP of 3.00, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-methyl-1,3-thiazol-5-yl)phenyl]methanamine;hydrochloride is sourced from PubChem (CID 131801125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).