C36H40BF4N — CID 131801538
3,6-ditert-butyl-10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium tetrafluoroborate (PubChem CID 131801538) has the molecular formula C36H40BF4N and a molecular weight of 573.53 g/mol. Its IUPAC name is 3,6-ditert-butyl-10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium tetrafluoroborate.
| Compound Name | 3,6-ditert-butyl-10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium tetrafluoroborate |
|---|---|
| PubChem CID | 131801538 |
| Molecular Formula | C36H40BF4N |
| Molecular Weight | 573.53 g/mol |
| Exact Mass | 573.32 |
| IUPAC Name | 3,6-ditert-butyl-10-phenyl-9-(2,4,6-trimethylphenyl)acridin-10-ium tetrafluoroborate |
| SMILES | Cc1cc(C)c(-c2c3ccc(C(C)(C)C)cc3[n+](-c3ccccc3)c3cc(C(C)(C)C)ccc23)c(C)c1.F[B-](F)(F)F |
| InChI | InChI=1S/C36H40N.BF4/c1-23-19-24(2)33(25(3)20-23)34-29-17-15-26(35(4,5)6)21-31(29)37(28-13-11-10-12-14-28)32-22-27(36(7,8)9)16-18-30(32)34;2-1(3,4)5/h10-22H,1-9H3;/q+1;-1 |
| InChIKey | YUNSHKYOOCWQRB-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.53 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|