About [(2S)-1-decanoyloxy-3-hydroxypropan-2-yl] 10-methyldodecanoate
[(2S)-1-decanoyloxy-3-hydroxypropan-2-yl] 10-methyldodecanoate (PubChem CID 131802113) has the molecular formula C26H50O5
and a molecular weight of 442.68 g/mol. Its IUPAC name is [(2S)-1-decanoyloxy-3-hydroxypropan-2-yl] 10-methyldodecanoate.
Molecular Properties
| Compound Name | [(2S)-1-decanoyloxy-3-hydroxypropan-2-yl] 10-methyldodecanoate |
| PubChem CID | 131802113 |
| Molecular Formula | C26H50O5 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.37 |
| IUPAC Name | [(2S)-1-decanoyloxy-3-hydroxypropan-2-yl] 10-methyldodecanoate |
| SMILES | CCCCCCCCCC(=O)OC[C@H](CO)OC(=O)CCCCCCCCC(C)CC |
| InChI | InChI=1S/C26H50O5/c1-4-6-7-8-9-13-16-19-25(28)30-22-24(21-27)31-26(29)20-17-14-11-10-12-15-18-23(3)5-2/h23-24,27H,4-22H2,1-3H3/t23?,24-/m0/s1 |
| InChIKey | AMRSBVODZRRKES-CGAIIQECSA-N |
| XLogP | 6.74 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-1-decanoyloxy-3-hydroxypropan-2-yl] 10-methyldodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-decanoyloxy-3-hydroxypropan-2-yl] 10-methyldodecanoate?
The IUPAC name of [(2S)-1-decanoyloxy-3-hydroxypropan-2-yl] 10-methyldodecanoate (CID 131802113) is [(2S)-1-decanoyloxy-3-hydroxypropan-2-yl] 10-methyldodecanoate.
What is the SMILES notation for [(2S)-1-decanoyloxy-3-hydroxypropan-2-yl] 10-methyldodecanoate?
The canonical SMILES for [(2S)-1-decanoyloxy-3-hydroxypropan-2-yl] 10-methyldodecanoate is CCCCCCCCCC(=O)OC[C@H](CO)OC(=O)CCCCCCCCC(C)CC.
What is the InChIKey of [(2S)-1-decanoyloxy-3-hydroxypropan-2-yl] 10-methyldodecanoate?
The InChIKey is AMRSBVODZRRKES-CGAIIQECSA-N. The full InChI is InChI=1S/C26H50O5/c1-4-6-7-8-9-13-16-19-25(28)30-22-24(21-27)31-26(29)20-17-14-11-10-12-15-18-23(3)5-2/h23-24,27H,4-22H2,1-3H3/t23?,24-/m0/s1.
What are the key properties of [(2S)-1-decanoyloxy-3-hydroxypropan-2-yl] 10-methyldodecanoate?
[(2S)-1-decanoyloxy-3-hydroxypropan-2-yl] 10-methyldodecanoate has a molecular weight of 442.68 g/mol, XLogP of 6.74, 22 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-decanoyloxy-3-hydroxypropan-2-yl] 10-methyldodecanoate is sourced from PubChem (CID 131802113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).